CAS 1016167-99-9 appears in our catalog under these names: (S)-tert-Butyl (piperidin-3-ylmethyl)carbamate, 97%, (S)–tert–butyl (piperidin–3–ylmethyl)carbamate, S-Piperidin-3-ylmethyl-carbamic acid tert-butyl ester, (S)-tert-butyl (piperidin-3-ylmethyl)carbamate 97%, (S)-1-piperidin-3-ylmethylcarbamic acid tert-butyl ester, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 50g, 250mg.
Tert-butyl N-[[(3S)-piperidin-3-yl]methyl]carbamate (CAS 1016167-99-9) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[[(3S)-piperidin-3-yl]methyl]carbamate. InChIKey: KHPQHXGYYXYTDN-VIFPVBQESA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[[(3S)-piperidin-3-yl]methyl]carbamate |
| InChIKey | KHPQHXGYYXYTDN-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCCNC1 |
Computed by PubChem (NCBI)