Products 1016506-81-2
CAS 1016506-81-2 is the registry number for 1-(4-Fluorophenyl)-2,2-dimethylpropan-1-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(4-fluorophenyl)-2,2-dimethylpropan-1-amine (CAS 1016506-81-2) is a chemical compound with the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,2-dimethylpropan-1-amine. InChIKey: ZUCBPXHMAQFYAI-UHFFFAOYSA-N.
| Molecular formula | C11H16FN |
|---|---|
| Molecular weight | 181.25 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | ZUCBPXHMAQFYAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=C(C=C1)F)N |
Computed by PubChem (NCBI)