CAS 681514-01-2 appears in our catalog under these names: 1-(3-Fluorophenyl)-2,2-dimethylpropan-1-amine, 95%, 1-(3-Fluorophenyl)-2,2-dimethylpropan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(3-fluorophenyl)-2,2-dimethylpropan-1-amine (CAS 681514-01-2) is a chemical compound with the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. IUPAC name: 1-(3-fluorophenyl)-2,2-dimethylpropan-1-amine. InChIKey: ONHZOAAJDYSRRQ-UHFFFAOYSA-N.
| Molecular formula | C11H16FN |
|---|---|
| Molecular weight | 181.25 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | ONHZOAAJDYSRRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC(=CC=C1)F)N |
Computed by PubChem (NCBI)