Products 1016508-86-3
CAS 1016508-86-3 is the registry number for (4-Fluorophenyl)(3-methanesulfonylphenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-fluorophenyl)-(3-methylsulfonylphenyl)methanamine (CAS 1016508-86-3) is a chemical compound with the molecular formula C14H14FNO2S and a molecular weight of 279.33 g/mol. IUPAC name: (4-fluorophenyl)-(3-methylsulfonylphenyl)methanamine. InChIKey: ZFRWQLCFUWBLER-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO2S |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (4-fluorophenyl)-(3-methylsulfonylphenyl)methanamine |
| InChIKey | ZFRWQLCFUWBLER-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C(C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)