Products 2258608-78-3
CAS 2258608-78-3 appears in our catalog under these names: UCM-1306/ 100%, UCM–1306, UCM-1306, 99.49%, UCM-1306, 98%, UCM-1306. Offered by: TargetMol, GLPBio, MedChemExpress, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 10 mg.
[4-[2-(fluoromethoxy)phenyl]phenyl]-imino-methyl-oxo-lambda6-sulfane (CAS 2258608-78-3) is a chemical compound with the molecular formula C14H14FNO2S and a molecular weight of 279.33 g/mol. IUPAC name: [4-[2-(fluoromethoxy)phenyl]phenyl]-imino-methyl-oxo-lambda6-sulfane. InChIKey: VCSBOASGFYJGGT-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO2S |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | [4-[2-(fluoromethoxy)phenyl]phenyl]-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | VCSBOASGFYJGGT-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=C(C=C1)C2=CC=CC=C2OCF |
Computed by PubChem (NCBI)