Products 1016522-03-4
CAS 1016522-03-4 is the registry number for N-(2,3-Dihydro-1H-indene-5-carbonyl)-N-methylglycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]acetic acid (CAS 1016522-03-4) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 2-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]acetic acid. InChIKey: FFFSITGNPKQURG-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 2-[2,3-dihydro-1H-indene-5-carbonyl(methyl)amino]acetic acid |
| InChIKey | FFFSITGNPKQURG-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)C1=CC2=C(CCC2)C=C1 |
Computed by PubChem (NCBI)