Products 101664-56-6

CAS 101664-56-6 is the registry number for 2-Chloro-3-fluoro-4-nitropyridine 1-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-3-fluoro-4-nitro-1-oxidopyridin-1-ium (CAS 101664-56-6) is a chemical compound with the molecular formula C5H2ClFN2O3 and a molecular weight of 192.53 g/mol. IUPAC name: 2-chloro-3-fluoro-4-nitro-1-oxidopyridin-1-ium. InChIKey: IQKSCEDCDQGAAO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2ClFN2O3
Molecular weight192.53 g/mol
IUPAC name2-chloro-3-fluoro-4-nitro-1-oxidopyridin-1-ium
InChIKeyIQKSCEDCDQGAAO-UHFFFAOYSA-N
SMILESC1=C[N+](=C(C(=C1[N+](=O)[O-])F)Cl)[O-]

Computed by PubChem (NCBI)