CAS 1016680-39-9 appears in our catalog under these names: tert-Butyl N-(2-amino-1-(2,4-difluorophenyl)ethyl)carbamate, 95%, tert-Butyl N-(2-amino-1-(2,4-difluorophenyl)ethyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl N-[2-amino-1-(2,4-difluorophenyl)ethyl]carbamate (CAS 1016680-39-9) is a chemical compound with the molecular formula C13H18F2N2O2 and a molecular weight of 272.29 g/mol. IUPAC name: tert-butyl N-[2-amino-1-(2,4-difluorophenyl)ethyl]carbamate. InChIKey: LZPQJWNVGUJWOO-UHFFFAOYSA-N.
| Molecular formula | C13H18F2N2O2 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | tert-butyl N-[2-amino-1-(2,4-difluorophenyl)ethyl]carbamate |
| InChIKey | LZPQJWNVGUJWOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CN)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)