CAS 2356297-18-0 is the registry number for tert-Butyl (2-(4-aminophenyl)-2,2-difluoroethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[2-(4-aminophenyl)-2,2-difluoroethyl]carbamate (CAS 2356297-18-0) is a chemical compound with the molecular formula C13H18F2N2O2 and a molecular weight of 272.29 g/mol. IUPAC name: tert-butyl N-[2-(4-aminophenyl)-2,2-difluoroethyl]carbamate. InChIKey: HPVNSEPTGWGICK-UHFFFAOYSA-N.
| Molecular formula | C13H18F2N2O2 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | tert-butyl N-[2-(4-aminophenyl)-2,2-difluoroethyl]carbamate |
| InChIKey | HPVNSEPTGWGICK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C1=CC=C(C=C1)N)(F)F |
Computed by PubChem (NCBI)