CAS 1016680-52-6 is the registry number for Methyl 2-{4-(1-(hydroxyimino)ethyl)phenoxy}acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]acetate (CAS 1016680-52-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]acetate. InChIKey: LJNILCOUYGLIOE-XYOKQWHBSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | methyl 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]acetate |
| InChIKey | LJNILCOUYGLIOE-XYOKQWHBSA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)OCC(=O)OC |
Computed by PubChem (NCBI)