Products 1016680-52-6

CAS 1016680-52-6 is the registry number for Methyl 2-{4-(1-(hydroxyimino)ethyl)phenoxy}acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]acetate (CAS 1016680-52-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]acetate. InChIKey: LJNILCOUYGLIOE-XYOKQWHBSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC namemethyl 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]acetate
InChIKeyLJNILCOUYGLIOE-XYOKQWHBSA-N
SMILESC/C(=N\O)/C1=CC=C(C=C1)OCC(=O)OC

Computed by PubChem (NCBI)