CAS 1016689-45-4 is the registry number for 4-(Chlorosulfonyl)-2,5-dimethylfuran-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 10g.
4-chlorosulfonyl-2,5-dimethylfuran-3-carboxylic acid (CAS 1016689-45-4) is a chemical compound with the molecular formula C7H7ClO5S and a molecular weight of 238.65 g/mol. IUPAC name: 4-chlorosulfonyl-2,5-dimethylfuran-3-carboxylic acid. InChIKey: HQGKSNBJJARVOL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO5S |
|---|---|
| Molecular weight | 238.65 g/mol |
| IUPAC name | 4-chlorosulfonyl-2,5-dimethylfuran-3-carboxylic acid |
| InChIKey | HQGKSNBJJARVOL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(O1)C)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)