CAS 344308-91-4 is the registry number for Methyl 4-(chlorosulfonyl)-5-methylfuran-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-chlorosulfonyl-5-methylfuran-2-carboxylate (CAS 344308-91-4) is a chemical compound with the molecular formula C7H7ClO5S and a molecular weight of 238.65 g/mol. IUPAC name: methyl 4-chlorosulfonyl-5-methylfuran-2-carboxylate. InChIKey: RADATWVEONYXFI-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO5S |
|---|---|
| Molecular weight | 238.65 g/mol |
| IUPAC name | methyl 4-chlorosulfonyl-5-methylfuran-2-carboxylate |
| InChIKey | RADATWVEONYXFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C(=O)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)