CAS 1016697-24-7 appears in our catalog under these names: 2-(3-Amino-4-fluorophenyl)-1,2-thiazolidine-1,1-dione, 95%, 2-(3-Amino-4-fluorophenyl)-1,2-thiazolidine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoroaniline (CAS 1016697-24-7) is a chemical compound with the molecular formula C9H11FN2O2S and a molecular weight of 230.26 g/mol. IUPAC name: 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoroaniline. InChIKey: QQTJCVCJNLNKIH-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O2S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoroaniline |
| InChIKey | QQTJCVCJNLNKIH-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC(=C(C=C2)F)N |
Computed by PubChem (NCBI)