CAS 1016760-55-6 appears in our catalog under these names: 2-(5-Amino-2-fluorophenyl)isothiazolidine 1,1-dioxide, 95%, 3-​(1,​1-Dioxido-​2-​isothiazolidinyl)​-​4-​fluoro-benzenamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-fluoroaniline (CAS 1016760-55-6) is a chemical compound with the molecular formula C9H11FN2O2S and a molecular weight of 230.26 g/mol. IUPAC name: 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-fluoroaniline. InChIKey: DKVNISKJNLPACR-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O2S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-fluoroaniline |
| InChIKey | DKVNISKJNLPACR-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=C(C=CC(=C2)N)F |
Computed by PubChem (NCBI)