Products 1016697-56-5

CAS 1016697-56-5 is the registry number for 1-(4-Bromo-2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-bromo-2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 1016697-56-5) is a chemical compound with the molecular formula C11H9BrFNO3 and a molecular weight of 302.10 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: XOCQMDMNCXKMOT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BrFNO3
Molecular weight302.10 g/mol
IUPAC name1-(4-bromo-2-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyXOCQMDMNCXKMOT-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=C(C=C(C=C2)Br)F)C(=O)O

Computed by PubChem (NCBI)