CAS 1326814-83-8 is the registry number for 3-(4-Bromo-2-fluorophenyl)-5-methyl-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CAS 1326814-83-8) is a chemical compound with the molecular formula C11H9BrFNO3 and a molecular weight of 302.10 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid. InChIKey: QYANCOVURORQSS-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| InChIKey | QYANCOVURORQSS-UHFFFAOYSA-N |
| SMILES | CC1(CC(=NO1)C2=C(C=C(C=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)