CAS 1016704-74-7 is the registry number for (1,4-Diazepan-1-yl)(3,5-difluorophenyl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-diazepan-1-yl-(3,5-difluorophenyl)methanone (CAS 1016704-74-7) is a chemical compound with the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. IUPAC name: 1,4-diazepan-1-yl-(3,5-difluorophenyl)methanone. InChIKey: RXCBYVKGQFQBHX-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 1,4-diazepan-1-yl-(3,5-difluorophenyl)methanone |
| InChIKey | RXCBYVKGQFQBHX-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)