CAS 333742-29-3 appears in our catalog under these names: 1-(3,4-Difluorobenzoyl)-4-methylpiperazine, 95%, (3,4-Difluorophenyl)(4-methylpiperazin-1-yl)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(3,4-difluorophenyl)-(4-methylpiperazin-1-yl)methanone (CAS 333742-29-3) is a chemical compound with the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. IUPAC name: (3,4-difluorophenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: ZCPNSVBDWJVJSY-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (3,4-difluorophenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | ZCPNSVBDWJVJSY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)