CAS 1016707-67-7 is the registry number for 4-(2-Bromo-4-fluorophenoxy)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(2-bromo-4-fluorophenoxy)pyridine (CAS 1016707-67-7) is a chemical compound with the molecular formula C11H7BrFNO and a molecular weight of 268.08 g/mol. IUPAC name: 4-(2-bromo-4-fluorophenoxy)pyridine. InChIKey: SJVJOTCFTZGJQG-UHFFFAOYSA-N.
| Molecular formula | C11H7BrFNO |
|---|---|
| Molecular weight | 268.08 g/mol |
| IUPAC name | 4-(2-bromo-4-fluorophenoxy)pyridine |
| InChIKey | SJVJOTCFTZGJQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OC2=CC=NC=C2 |
Computed by PubChem (NCBI)