CAS 1823325-40-1 appears in our catalog under these names: 3-Bromo-1-(3-fluorophenyl)pyridin-2(1h)-one, 95%, 3-Bromo-1-(3-fluorophenyl)pyridin-2(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
3-bromo-1-(3-fluorophenyl)pyridin-2-one (CAS 1823325-40-1) is a chemical compound with the molecular formula C11H7BrFNO and a molecular weight of 268.08 g/mol. IUPAC name: 3-bromo-1-(3-fluorophenyl)pyridin-2-one. InChIKey: VRZVQKOSOAEFKR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrFNO |
|---|---|
| Molecular weight | 268.08 g/mol |
| IUPAC name | 3-bromo-1-(3-fluorophenyl)pyridin-2-one |
| InChIKey | VRZVQKOSOAEFKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=CC=C(C2=O)Br |
Computed by PubChem (NCBI)