Products 1016711-54-8
CAS 1016711-54-8 appears in our catalog under these names: 5-(3,4-Difluorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3,4-Difluorophenyl)-1,3,4-oxadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-(3,4-difluorophenyl)-1,3,4-oxadiazol-2-amine (CAS 1016711-54-8) is a chemical compound with the molecular formula C8H5F2N3O and a molecular weight of 197.14 g/mol. IUPAC name: 5-(3,4-difluorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: QDKYRZKLWDRHBF-UHFFFAOYSA-N.
| Molecular formula | C8H5F2N3O |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 5-(3,4-difluorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | QDKYRZKLWDRHBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NN=C(O2)N)F)F |
Computed by PubChem (NCBI)