Products 1504957-58-7
CAS 1504957-58-7 is the registry number for 3-(2,6-Difluorophenyl)-1,2,4-oxadiazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-amine (CAS 1504957-58-7) is a chemical compound with the molecular formula C8H5F2N3O and a molecular weight of 197.14 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-amine. InChIKey: NTYPFXODRZUBMB-UHFFFAOYSA-N.
| Molecular formula | C8H5F2N3O |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-amine |
| InChIKey | NTYPFXODRZUBMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NOC(=N2)N)F |
Computed by PubChem (NCBI)