CAS 1016751-92-0 appears in our catalog under these names: 4-Fluoro-n-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide, 95%, 4-Fluoro-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-fluoro-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide (CAS 1016751-92-0) is a chemical compound with the molecular formula C16H15FN2O and a molecular weight of 270.30 g/mol. IUPAC name: 4-fluoro-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide. InChIKey: GGSFYRLTOCKRLN-UHFFFAOYSA-N.
| Molecular formula | C16H15FN2O |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | 4-fluoro-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide |
| InChIKey | GGSFYRLTOCKRLN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=C2NC(=O)C3=CC=C(C=C3)F)NC1 |
Computed by PubChem (NCBI)