Products 491867-69-7
CAS 491867-69-7 is the registry number for N-(4-fluorophenyl)-2-indolinylethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,3-dihydroindol-1-yl)-N-(4-fluorophenyl)acetamide (CAS 491867-69-7) is a chemical compound with the molecular formula C16H15FN2O and a molecular weight of 270.30 g/mol. IUPAC name: 2-(2,3-dihydroindol-1-yl)-N-(4-fluorophenyl)acetamide. InChIKey: DJKUSGCLYOTWMB-UHFFFAOYSA-N.
| Molecular formula | C16H15FN2O |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | 2-(2,3-dihydroindol-1-yl)-N-(4-fluorophenyl)acetamide |
| InChIKey | DJKUSGCLYOTWMB-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)CC(=O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)