CAS 1016757-52-0 is the registry number for 2-Chloro-N-(5-chloro-2,4-dimethoxyphenyl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)propanamide (CAS 1016757-52-0) is a chemical compound with the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. IUPAC name: 2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)propanamide. InChIKey: CIKNJZYSUKFIRQ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO3 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)propanamide |
| InChIKey | CIKNJZYSUKFIRQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=C(C=C1OC)OC)Cl)Cl |
Computed by PubChem (NCBI)