CAS 2055119-15-6 is the registry number for tert-butyl N-(2,6-dichloro-4-hydroxyphenyl)carbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-(2,6-dichloro-4-hydroxyphenyl)carbamate (CAS 2055119-15-6) is a chemical compound with the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. IUPAC name: tert-butyl N-(2,6-dichloro-4-hydroxyphenyl)carbamate. InChIKey: ZXOPJQPPNOBACY-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO3 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | tert-butyl N-(2,6-dichloro-4-hydroxyphenyl)carbamate |
| InChIKey | ZXOPJQPPNOBACY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1Cl)O)Cl |
Computed by PubChem (NCBI)