CAS 1016793-12-6 is the registry number for 6-(2,3-Dichlorophenoxy)pyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(2,3-dichlorophenoxy)pyridine-3-carbonitrile (CAS 1016793-12-6) is a chemical compound with the molecular formula C12H6Cl2N2O and a molecular weight of 265.09 g/mol. IUPAC name: 6-(2,3-dichlorophenoxy)pyridine-3-carbonitrile. InChIKey: PXLQYCSWKOVCIB-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2O |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 6-(2,3-dichlorophenoxy)pyridine-3-carbonitrile |
| InChIKey | PXLQYCSWKOVCIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=NC=C(C=C2)C#N |
Computed by PubChem (NCBI)