CAS 142499-56-7 is the registry number for 6-(3,4-Dichlorophenyl)-2-oxo-1,2-dihydropyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-(3,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile (CAS 142499-56-7) is a chemical compound with the molecular formula C12H6Cl2N2O and a molecular weight of 265.09 g/mol. IUPAC name: 6-(3,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile. InChIKey: JGSDPPNDXFQWIK-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2O |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 6-(3,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | JGSDPPNDXFQWIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=C(C(=O)N2)C#N)Cl)Cl |
Computed by PubChem (NCBI)