Products 1016798-13-2

CAS 1016798-13-2 is the registry number for 6-Bromo-2-(pyridin-4-yl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-bromo-2-pyridin-4-ylquinoline-4-carboxylic acid (CAS 1016798-13-2) is a chemical compound with the molecular formula C15H9BrN2O2 and a molecular weight of 329.15 g/mol. IUPAC name: 6-bromo-2-pyridin-4-ylquinoline-4-carboxylic acid. InChIKey: PQSWWAOGYQHXAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9BrN2O2
Molecular weight329.15 g/mol
IUPAC name6-bromo-2-pyridin-4-ylquinoline-4-carboxylic acid
InChIKeyPQSWWAOGYQHXAJ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)C(=CC(=N2)C3=CC=NC=C3)C(=O)O

Computed by PubChem (NCBI)