CAS 1022532-20-2 is the registry number for 2-(((5-bromo-2-pyridyl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(5-bromo-2-pyridinyl)iminomethyl]-3-hydroxyinden-1-one (CAS 1022532-20-2) is a chemical compound with the molecular formula C15H9BrN2O2 and a molecular weight of 329.15 g/mol. IUPAC name: 2-[(5-bromo-2-pyridinyl)iminomethyl]-3-hydroxyinden-1-one. InChIKey: DPKVIUSFSDSRGU-UHFFFAOYSA-N.
| Molecular formula | C15H9BrN2O2 |
|---|---|
| Molecular weight | 329.15 g/mol |
| IUPAC name | 2-[(5-bromo-2-pyridinyl)iminomethyl]-3-hydroxyinden-1-one |
| InChIKey | DPKVIUSFSDSRGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NC3=NC=C(C=C3)Br)O |
Computed by PubChem (NCBI)