CAS 1016836-49-9 is the registry number for 4-Amino-N-(benzo[d]thiazol-2-yl)-3-methylbenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-N-(1,3-benzothiazol-2-yl)-3-methylbenzamide (CAS 1016836-49-9) is a chemical compound with the molecular formula C15H13N3OS and a molecular weight of 283.4 g/mol. IUPAC name: 4-amino-N-(1,3-benzothiazol-2-yl)-3-methylbenzamide. InChIKey: WNJYGWWUKCAAQK-UHFFFAOYSA-N.
| Molecular formula | C15H13N3OS |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 4-amino-N-(1,3-benzothiazol-2-yl)-3-methylbenzamide |
| InChIKey | WNJYGWWUKCAAQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NC2=NC3=CC=CC=C3S2)N |
Computed by PubChem (NCBI)