Products 948207-69-0
CAS 948207-69-0 is the registry number for 3-Amino-N-benzylthieno[2,3-b]pyridine-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-N-benzylthieno[2,3-b]pyridine-2-carboxamide (CAS 948207-69-0) is a chemical compound with the molecular formula C15H13N3OS and a molecular weight of 283.4 g/mol. IUPAC name: 3-amino-N-benzylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: NKXCJJKNCZKKEI-UHFFFAOYSA-N.
| Molecular formula | C15H13N3OS |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 3-amino-N-benzylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | NKXCJJKNCZKKEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=C(C3=C(S2)N=CC=C3)N |
Computed by PubChem (NCBI)