Products 1016852-21-3
CAS 1016852-21-3 is the registry number for 3-{4-(1-(Hydroxyimino)ethyl)phenyl}-1-phenylurea. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3-phenylurea (CAS 1016852-21-3) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: 1-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3-phenylurea. InChIKey: MNFHPLAACXQPQT-WOJGMQOQSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 1-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3-phenylurea |
| InChIKey | MNFHPLAACXQPQT-WOJGMQOQSA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)NC(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)