CAS 1016854-57-1 is the registry number for 5-Bromo-2-fluoro-N-(5-methylisoxazol-3-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide (CAS 1016854-57-1) is a chemical compound with the molecular formula C11H8BrFN2O2 and a molecular weight of 299.10 g/mol. IUPAC name: 5-bromo-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide. InChIKey: FCRHHYVDGDEDDT-UHFFFAOYSA-N.
| Molecular formula | C11H8BrFN2O2 |
|---|---|
| Molecular weight | 299.10 g/mol |
| IUPAC name | 5-bromo-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| InChIKey | FCRHHYVDGDEDDT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)