Products 1260642-39-4

CAS 1260642-39-4 is the registry number for 2-(4-Bromo-2-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-bromo-2-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid (CAS 1260642-39-4) is a chemical compound with the molecular formula C11H8BrFN2O2 and a molecular weight of 299.10 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid. InChIKey: XOCKDFJCKGOTNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8BrFN2O2
Molecular weight299.10 g/mol
IUPAC name2-(4-bromo-2-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid
InChIKeyXOCKDFJCKGOTNQ-UHFFFAOYSA-N
SMILESCC1=C(N=C(N1)C2=C(C=C(C=C2)Br)F)C(=O)O

Computed by PubChem (NCBI)