Products 1016871-27-4
CAS 1016871-27-4 appears in our catalog under these names: 2-Chloro-N-(2,6-diethylphenyl)propanamide, 95%, 2-Chloro-N-(2,6-diethylphenyl)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-chloro-N-(2,6-diethylphenyl)propanamide (CAS 1016871-27-4) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 2-chloro-N-(2,6-diethylphenyl)propanamide. InChIKey: FWQFMHNCEVNNTB-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 2-chloro-N-(2,6-diethylphenyl)propanamide |
| InChIKey | FWQFMHNCEVNNTB-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)