CAS 1016874-10-4 is the registry number for 3-Cyano-N-(5-methylthiazol-2-yl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyano-N-(5-methyl-1,3-thiazol-2-yl)benzenesulfonamide (CAS 1016874-10-4) is a chemical compound with the molecular formula C11H9N3O2S2 and a molecular weight of 279.3 g/mol. IUPAC name: 3-cyano-N-(5-methyl-1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: DHRHIOLUIRYZOI-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2S2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 3-cyano-N-(5-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | DHRHIOLUIRYZOI-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NS(=O)(=O)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)