CAS 314245-25-5 is the registry number for 3-(Benzo[4,5]thiazolo[2,3-c][1,2,4]triazol-3-ylsulfanyl)-propionic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propanoic acid (CAS 314245-25-5) is a chemical compound with the molecular formula C11H9N3O2S2 and a molecular weight of 279.3 g/mol. IUPAC name: 3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propanoic acid. InChIKey: SHBILBIKDTZGNX-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2S2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propanoic acid |
| InChIKey | SHBILBIKDTZGNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N3C(=NN=C3SCCC(=O)O)S2 |
Computed by PubChem (NCBI)