CAS 101693-27-0 appears in our catalog under these names: tert-Butyl (R)-2-acetoxypropanoate, 98%, tert-Butyl (R)-2-acetoxypropanoate, 95%, 95%, tert-Butyl (R)-2-acetoxypropanoate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl (2R)-2-acetyloxypropanoate (CAS 101693-27-0) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: tert-butyl (2R)-2-acetyloxypropanoate. InChIKey: PHNMHWJIWPTKNO-ZCFIWIBFSA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | tert-butyl (2R)-2-acetyloxypropanoate |
| InChIKey | PHNMHWJIWPTKNO-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)OC(C)(C)C)OC(=O)C |
Computed by PubChem (NCBI)