CAS 185836-75-3 appears in our catalog under these names: (R)-2-Methylsuccinic acid 4-tert-butyl ester, 95%, (R)-4-(tert-Butoxy)-2-methyl-4-oxobutanoic acid, 97%, 97%, (R)-4-(tert-Butoxy)-2-methyl-4-oxobutanoic acid, 97%, (R)-4-(tert-Butoxy)-2-methyl-4-oxobutanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
(2R)-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 185836-75-3) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: (2R)-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: RSLMNCHJSYDERN-ZCFIWIBFSA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2R)-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | RSLMNCHJSYDERN-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)