CAS 1017029-14-9 appears in our catalog under these names: 2-Bromo-n-(2,5-dichlorophenyl)-3-methylbutanamide, 95%, 2-Bromo-N-(2,5-dichlorophenyl)-3-methylbutanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-bromo-N-(2,5-dichlorophenyl)-3-methylbutanamide (CAS 1017029-14-9) is a chemical compound with the molecular formula C11H12BrCl2NO and a molecular weight of 325.03 g/mol. IUPAC name: 2-bromo-N-(2,5-dichlorophenyl)-3-methylbutanamide. InChIKey: AOFVNUQREPGTSD-UHFFFAOYSA-N.
| Molecular formula | C11H12BrCl2NO |
|---|---|
| Molecular weight | 325.03 g/mol |
| IUPAC name | 2-bromo-N-(2,5-dichlorophenyl)-3-methylbutanamide |
| InChIKey | AOFVNUQREPGTSD-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC1=C(C=CC(=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)