CAS 1040343-21-2 is the registry number for 2-Bromo-N-(3,4-dichlorophenyl)-3-methylbutanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-N-(3,4-dichlorophenyl)-3-methylbutanamide (CAS 1040343-21-2) is a chemical compound with the molecular formula C11H12BrCl2NO and a molecular weight of 325.03 g/mol. IUPAC name: 2-bromo-N-(3,4-dichlorophenyl)-3-methylbutanamide. InChIKey: AYCPIGPJEXSCHZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrCl2NO |
|---|---|
| Molecular weight | 325.03 g/mol |
| IUPAC name | 2-bromo-N-(3,4-dichlorophenyl)-3-methylbutanamide |
| InChIKey | AYCPIGPJEXSCHZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC1=CC(=C(C=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)