Products 1017035-01-6
CAS 1017035-01-6 appears in our catalog under these names: 1-(4-Bromo-2-fluorobenzoyl)piperidine, 97%, (4-Bromo-2-fluorophenyl)(piperidin-1-yl)methanone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 5g.
(4-bromo-2-fluorophenyl)-piperidin-1-ylmethanone (CAS 1017035-01-6) is a chemical compound with the molecular formula C12H13BrFNO and a molecular weight of 286.14 g/mol. IUPAC name: (4-bromo-2-fluorophenyl)-piperidin-1-ylmethanone. InChIKey: ZBGVACBSPVNCMO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrFNO |
|---|---|
| Molecular weight | 286.14 g/mol |
| IUPAC name | (4-bromo-2-fluorophenyl)-piperidin-1-ylmethanone |
| InChIKey | ZBGVACBSPVNCMO-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)