CAS 2535047-29-9 is the registry number for 1-(8-Bromo-7-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(8-bromo-7-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanone (CAS 2535047-29-9) is a chemical compound with the molecular formula C12H13BrFNO and a molecular weight of 286.14 g/mol. IUPAC name: 1-(8-bromo-7-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanone. InChIKey: MZUTXTCOXVCQIA-UHFFFAOYSA-N.
| Molecular formula | C12H13BrFNO |
|---|---|
| Molecular weight | 286.14 g/mol |
| IUPAC name | 1-(8-bromo-7-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanone |
| InChIKey | MZUTXTCOXVCQIA-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(N1)C(=O)C)C(=C(C=C2)F)Br |
Computed by PubChem (NCBI)