Products 1017055-32-1

CAS 1017055-32-1 is the registry number for 2-(2-Chloro-4-(chlorosulfonyl)phenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2-chloro-4-chlorosulfonylphenoxy)acetic acid (CAS 1017055-32-1) is a chemical compound with the molecular formula C8H6Cl2O5S and a molecular weight of 285.10 g/mol. IUPAC name: 2-(2-chloro-4-chlorosulfonylphenoxy)acetic acid. InChIKey: AQASVWNEUNDYEA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O5S
Molecular weight285.10 g/mol
IUPAC name2-(2-chloro-4-chlorosulfonylphenoxy)acetic acid
InChIKeyAQASVWNEUNDYEA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)Cl)OCC(=O)O

Computed by PubChem (NCBI)