CAS 57479-73-9 appears in our catalog under these names: 4-Chloro-5-(chlorosulfonyl)-2-methoxybenzoic acid, 97%, 4-Chloro-5-(chlorosulfonyl)-2-methoxybenzoic acid, 96%, 4-chloro-5-(chlorosulfonyl)-2-methoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g.
4-chloro-5-chlorosulfonyl-2-methoxybenzoic acid (CAS 57479-73-9) is a chemical compound with the molecular formula C8H6Cl2O5S and a molecular weight of 285.10 g/mol. IUPAC name: 4-chloro-5-chlorosulfonyl-2-methoxybenzoic acid. InChIKey: KGGQSUTYQMJRNQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O5S |
|---|---|
| Molecular weight | 285.10 g/mol |
| IUPAC name | 4-chloro-5-chlorosulfonyl-2-methoxybenzoic acid |
| InChIKey | KGGQSUTYQMJRNQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)