CAS 1017082-55-1 appears in our catalog under these names: (3-Bromo-4,5-dimethoxyphenyl)acetone, 95%, (3-Bromo-4,5-dimethoxyphenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
1-(3-bromo-4,5-dimethoxyphenyl)propan-2-one (CAS 1017082-55-1) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 1-(3-bromo-4,5-dimethoxyphenyl)propan-2-one. InChIKey: OKJWUGAMTFBMEZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 1-(3-bromo-4,5-dimethoxyphenyl)propan-2-one |
| InChIKey | OKJWUGAMTFBMEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C(=C1)Br)OC)OC |
Computed by PubChem (NCBI)