CAS 10171-92-3 appears in our catalog under these names: (S)-(+)-2-Methylglutaric acid dimethyl ester, 97%, Dimethyl (S)–(+)–2–Methylglutarate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g.
Dimethyl (2S)-2-methylpentanedioate (CAS 10171-92-3) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: dimethyl (2S)-2-methylpentanedioate. InChIKey: ZWKKRUNHAVNSFW-LURJTMIESA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | dimethyl (2S)-2-methylpentanedioate |
| InChIKey | ZWKKRUNHAVNSFW-LURJTMIESA-N |
| SMILES | C[C@@H](CCC(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)