Products 1017171-54-8
CAS 1017171-54-8 is the registry number for 6-(4-Methanesulfonylpiperazin-1-yl)pyridin-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(4-methylsulfonylpiperazin-1-yl)pyridin-3-amine (CAS 1017171-54-8) is a chemical compound with the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. IUPAC name: 6-(4-methylsulfonylpiperazin-1-yl)pyridin-3-amine. InChIKey: GNTLRGFRRDFLRJ-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O2S |
|---|---|
| Molecular weight | 256.33 g/mol |
| IUPAC name | 6-(4-methylsulfonylpiperazin-1-yl)pyridin-3-amine |
| InChIKey | GNTLRGFRRDFLRJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)