CAS 926196-79-4 appears in our catalog under these names: N-Cyclopentyl-6-hydrazinylpyridine-3-sulfonamide, 95%, N-Cyclopentyl-6-hydrazinylpyridine-3-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-cyclopentyl-6-hydrazinylpyridine-3-sulfonamide (CAS 926196-79-4) is a chemical compound with the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. IUPAC name: N-cyclopentyl-6-hydrazinylpyridine-3-sulfonamide. InChIKey: RYYWCZJCUNZWCF-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O2S |
|---|---|
| Molecular weight | 256.33 g/mol |
| IUPAC name | N-cyclopentyl-6-hydrazinylpyridine-3-sulfonamide |
| InChIKey | RYYWCZJCUNZWCF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NS(=O)(=O)C2=CN=C(C=C2)NN |
Computed by PubChem (NCBI)